| 
 | Compound Information | SONAR Target prediction |  | Name: | ETHAVERINE HYDROCHLORIDE |  | Unique Identifier: | SPE01501000 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 401.714 g/mol |  | X log p: | 15.917  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 49.28 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 10 |  | Canonical Smiles: | Cl.CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC |  | Source: | synthetic |  | Therapeutics: | antispasmodic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | LCB3 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7986±0.00162635 |  
		| Normalized OD Score: sc h | 0.9848±0.00770376 |  
		| Z-Score: | -0.8420±0.443267 |  
		| p-Value: | 0.42253 |  
		| Z-Factor: | -3.55068 |  
		| Fitness Defect: | 0.8615 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 18|G3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.30 Celcius |  | Date: | 2006-03-31 YYYY-MM-DD |  | Plate CH Control (+): | 0.040925±0.00212 |  | Plate DMSO Control (-): | 0.794475±0.01034 |  | Plate Z-Factor: | 0.9476 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 2 |  | 
 
	
		| 3280 | 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline |  
		| 5702159 | 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline hydrochloride |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 1145 | Additional Members: 7 | Rows returned: 1 |  | 
 
 |