| Compound Information | SONAR Target prediction | | Name: | ETHAVERINE HYDROCHLORIDE | | Unique Identifier: | SPE01501000 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 401.714 g/mol | | X log p: | 15.917 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 49.28 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 10 | | Canonical Smiles: | Cl.CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC | | Source: | synthetic | | Therapeutics: | antispasmodic |
| Species: |
4932 |
| Condition: |
RBL2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7192±0.0111723 |
| Normalized OD Score: sc h |
0.9933±0.0114528 |
| Z-Score: |
-0.3848±0.647389 |
| p-Value: |
0.670648 |
| Z-Factor: |
-32.6629 |
| Fitness Defect: |
0.3995 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 5|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.30 Celcius | | Date: | 2008-06-03 YYYY-MM-DD | | Plate CH Control (+): | 0.0409±0.00299 | | Plate DMSO Control (-): | 0.7108749999999999±0.01552 | | Plate Z-Factor: | 0.9176 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 3280 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline |
| 5702159 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline hydrochloride |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 1145 | Additional Members: 7 | Rows returned: 1 | |
|