Compound Information | SONAR Target prediction | Name: | ETHAVERINE HYDROCHLORIDE | Unique Identifier: | SPE01501000 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 401.714 g/mol | X log p: | 15.917 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.28 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 10 | Canonical Smiles: | Cl.CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC | Source: | synthetic | Therapeutics: | antispasmodic |
Species: |
4932 |
Condition: |
SPE01500521 |
Replicates: |
2 |
Raw OD Value: r im |
0.0607±0.00254558 |
Normalized OD Score: sc h |
0.8314±0.0300389 |
Z-Score: |
-2.0177±0.638977 |
p-Value: |
0.0654526 |
Z-Factor: |
-2.66054 |
Fitness Defect: |
2.7264 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|C5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.50 Celcius | Date: | 2007-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.046375±0.00171 | Plate DMSO Control (-): | 0.07869999999999999±0.32709 | Plate Z-Factor: | -2.3985 |
| png ps pdf |
DBLink | Rows returned: 2 | |
3280 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline |
5702159 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline hydrochloride |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1145 | Additional Members: 7 | Rows returned: 1 | |
|