| 
 | Compound Information | SONAR Target prediction |  | Name: | ENOXOLONE |  | Unique Identifier: | SPE01500990 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 425.327 g/mol |  | X log p: | -0.225  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O |  | Class: | triterpene |  | Source: | derivative |  | Therapeutics: | antitussive, antiinflammatory, antibacterial | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE00307050 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4542±0.0358503 |  
		| Normalized OD Score: sc h | 0.7454±0.0397102 |  
		| Z-Score: | -9.1117±0.918279 |  
		| p-Value: | 1.30968e-17 |  
		| Z-Factor: | -0.142762 |  
		| Fitness Defect: | 38.8742 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|C3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.10 Celcius |  | Date: | 2006-12-21 YYYY-MM-DD |  | Plate CH Control (+): | 0.03924999999999999±0.00209 |  | Plate DMSO Control (-): | 0.587375±0.04414 |  | Plate Z-Factor: | 0.8012 | 
 |  png ps
 pdf
 | 
 
 
	
		| 3230 | 10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2- carboxylic acid
 |  
		| 10114 | (2S,4aR,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid
 |  
		| 73398 | (2S,4aR,6aS,6aS,6bR,8aS,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid
 |  
		| 111253 | (2S,4aR,6aS,6aS,6bR,8aS,12aS,14bR)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12, 14b-dodecahydropicene-2-carboxylic acid
 |  
		| 112111 | (2R,4aR,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid
 |  
		| 125828 | (2R,4aR,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10 ,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid
 |  
 | internal high similarity DBLink  | Rows returned: 13 | 1 2 3 Next >> | 
 
 | nonactive | Cluster 6100 | Additional Members: 5 | Rows returned: 3 |  | 
 
 |