Compound Information | SONAR Target prediction | Name: | ENOXOLONE | Unique Identifier: | SPE01500990 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 425.327 g/mol | X log p: | -0.225 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | Class: | triterpene | Source: | derivative | Therapeutics: | antitussive, antiinflammatory, antibacterial |
Species: |
4932 |
Condition: |
SPE00330051 |
Replicates: |
2 |
Raw OD Value: r im |
0.4669±0.0246073 |
Normalized OD Score: sc h |
0.8402±0.026224 |
Z-Score: |
-4.0001±0.374474 |
p-Value: |
0.000103763 |
Z-Factor: |
-0.37583 |
Fitness Defect: |
9.1734 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.30 Celcius | Date: | 2006-12-21 YYYY-MM-DD | Plate CH Control (+): | 0.0388±0.00229 | Plate DMSO Control (-): | 0.5352250000000001±0.03388 | Plate Z-Factor: | 0.7802 |
| png ps pdf |
7067782 |
(2S,4aR,6aS,6aS,6bR,8aS,10R,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate |
7067783 |
(2S,4aR,6aS,6aS,6bR,8aS,10R,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid |
7067784 |
(2S,4aR,6aS,6aS,6bR,8aS,10R,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate |
7067785 |
(2S,4aR,6aS,6aS,6bR,8aR,10R,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate |
7067786 |
(2S,4aR,6aS,6aS,6bR,8aR,10R,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid |
7067787 |
(2S,4aR,6aS,6aR,6bR,8aS,10R,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate |
internal high similarity DBLink | Rows returned: 13 | 1 2 3 Next >> |
active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|