| Compound Information | SONAR Target prediction | | Name: | ENOXOLONE | | Unique Identifier: | SPE01500990 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 425.327 g/mol | | X log p: | -0.225 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | | Class: | triterpene | | Source: | derivative | | Therapeutics: | antitussive, antiinflammatory, antibacterial |
| Species: |
4932 |
| Condition: |
SPE01500330 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3073±0.0248194 |
| Normalized OD Score: sc h |
0.6143±0.029928 |
| Z-Score: |
-4.3355±0.104405 |
| p-Value: |
0.0000153301 |
| Z-Factor: |
-0.229773 |
| Fitness Defect: |
11.0857 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|C3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.50 Celcius | | Date: | 2006-12-22 YYYY-MM-DD | | Plate CH Control (+): | 0.0385±0.00228 | | Plate DMSO Control (-): | 0.5045000000000001±0.07073 | | Plate Z-Factor: | 0.5700 |
| png ps pdf |
| 6560142 |
(2S,4aS,6aS,6aS,6bS,8aR,12aS,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12, 14b-dodecahydropicene-2-carboxylate |
| 6560143 |
(2S,4aS,6aS,6aS,6bS,8aR,12aS,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12, 14b-dodecahydropicene-2-carboxylic acid |
| 6566062 |
(4S)-4-[(3S,5R,8R,10R,13S,14R,17R)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoate |
| 6566063 |
(4S)-4-[(3S,5R,8R,10R,13S,14R,17R)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 6590344 |
(2S,4aS,6aS,6aS,6bS,8aR,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate |
| 6590345 |
(2S,4aS,6aS,6aS,6bS,8aR,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid |
| internal high similarity DBLink | Rows returned: 13 | 1 2 3 Next >> |
| active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|