Compound Information | SONAR Target prediction | Name: | ENOXOLONE | Unique Identifier: | SPE01500990 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 425.327 g/mol | X log p: | -0.225 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | Class: | triterpene | Source: | derivative | Therapeutics: | antitussive, antiinflammatory, antibacterial |
Species: |
4932 |
Condition: |
STO1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5734±0.0357796 |
Normalized OD Score: sc h |
1.1165±0.034044 |
Z-Score: |
4.1531±1.28242 |
p-Value: |
0.0005848 |
Z-Factor: |
-0.775523 |
Fitness Defect: |
7.4442 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 7|A11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2007-12-06 YYYY-MM-DD | Plate CH Control (+): | 0.041175±0.00051 | Plate DMSO Control (-): | 0.4905±0.01655 | Plate Z-Factor: | 0.8724 |
| png ps pdf |
5284133 |
(4R)-4-[(3S,5R,10S,13S,14R,17R)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoic acid |
5284143 |
(4R)-4-[(8R,9S,10R,12R,13R,14S,17R)-12-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodeca hydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5317760 |
(4aR,6bR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b- dodecahydro-1H-picene-2-carboxylic acid |
5702158 |
(2S,4aR,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11, 12,14b-dodecahydro-1H-picene-2-carboxylic acid |
5702287 |
(2S,4aR,6aS,6bR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11, 12,14b-dodecahydro-1H-picene-2-carboxylic acid |
6548061 |
(4S)-4-[(3R,5S,8S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoic acid |
internal high similarity DBLink | Rows returned: 13 | 1 2 3 Next >> |
active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|