| Compound Information | SONAR Target prediction | | Name: | ENOXOLONE | | Unique Identifier: | SPE01500990 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 425.327 g/mol | | X log p: | -0.225 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | | Class: | triterpene | | Source: | derivative | | Therapeutics: | antitussive, antiinflammatory, antibacterial |
| Species: |
4932 |
| Condition: |
SPE00200002 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5048±0.00820244 |
| Normalized OD Score: sc h |
0.8447±0.0150854 |
| Z-Score: |
-5.3944±0.105938 |
| p-Value: |
0.0000000746112 |
| Z-Factor: |
-0.059919 |
| Fitness Defect: |
16.411 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|C3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.10 Celcius | | Date: | 2006-12-15 YYYY-MM-DD | | Plate CH Control (+): | 0.04005±0.00193 | | Plate DMSO Control (-): | 0.594625±0.02685 | | Plate Z-Factor: | 0.8365 |
| png ps pdf |
| 5284133 |
(4R)-4-[(3S,5R,10S,13S,14R,17R)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 5284143 |
(4R)-4-[(8R,9S,10R,12R,13R,14S,17R)-12-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodeca hydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 5317760 |
(4aR,6bR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b- dodecahydro-1H-picene-2-carboxylic acid |
| 5702158 |
(2S,4aR,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11, 12,14b-dodecahydro-1H-picene-2-carboxylic acid |
| 5702287 |
(2S,4aR,6aS,6bR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11, 12,14b-dodecahydro-1H-picene-2-carboxylic acid |
| 6548061 |
(4S)-4-[(3R,5S,8S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| internal high similarity DBLink | Rows returned: 13 | 1 2 3 Next >> |
| active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|