Compound Information | SONAR Target prediction | Name: | ENOXOLONE | Unique Identifier: | SPE01500990 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 425.327 g/mol | X log p: | -0.225 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | Class: | triterpene | Source: | derivative | Therapeutics: | antitussive, antiinflammatory, antibacterial |
Species: |
4932 |
Condition: |
SPE01500330 |
Replicates: |
2 |
Raw OD Value: r im |
0.3073±0.0248194 |
Normalized OD Score: sc h |
0.6143±0.029928 |
Z-Score: |
-4.3355±0.104405 |
p-Value: |
0.0000153301 |
Z-Factor: |
-0.229773 |
Fitness Defect: |
11.0857 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.50 Celcius | Date: | 2006-12-22 YYYY-MM-DD | Plate CH Control (+): | 0.0385±0.00228 | Plate DMSO Control (-): | 0.5045000000000001±0.07073 | Plate Z-Factor: | 0.5700 |
| png ps pdf |
536316 |
4-(12-hydroxy-3-oxo-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pen tanoic acid |
3009628 |
(1R,4aS,5R,8aS)-6-formyl-1,4a-dimethyl-5-(4-methyl-3-oxo-pentyl)-2,3,4,5,8,8a-hexahydronaphthalene-1-car boxylic acid |
3083860 |
(2S,4aR,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate; aluminum(+3) cation |
3129312 |
2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylic acid |
3440917 |
10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2- carboxylate |
3515748 |
7a-methyl-1-(6-methylheptan-2-yl)-5-(1-methyl-4-oxo-1-cyclohex-2-enyl)-1,2,3,3a,4,5,6,7-octahydroindene- 4-carboxylic acid |
internal high similarity DBLink | Rows returned: 13 | 1 2 3 Next >> |
active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|