Compound Information | SONAR Target prediction | Name: | ENOXOLONE | Unique Identifier: | SPE01500990 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 425.327 g/mol | X log p: | -0.225 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | Class: | triterpene | Source: | derivative | Therapeutics: | antitussive, antiinflammatory, antibacterial |
Species: |
4932 |
Condition: |
SPE01502223 |
Replicates: |
2 |
Raw OD Value: r im |
0.3411±0.0217082 |
Normalized OD Score: sc h |
0.7344±0.0351138 |
Z-Score: |
-5.0751±0.0321931 |
p-Value: |
0.000000390014 |
Z-Factor: |
-0.321849 |
Fitness Defect: |
14.7571 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 22.60 Celcius | Date: | 2006-11-29 YYYY-MM-DD | Plate CH Control (+): | 0.04055±0.00214 | Plate DMSO Control (-): | 0.440925±0.04520 | Plate Z-Factor: | 0.6847 |
| png ps pdf |
201991 |
azanium (2S,4aR,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate |
229868 |
(2S,4aR,6aS,6aS,6bR,8aS,12aS,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12, 14b-dodecahydropicene-2-carboxylic acid |
255570 |
(4R)-4-[(3S,5R,8S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoic acid |
315197 |
2-(4a-methyl-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-2-yl)acetic acid |
348408 |
4-(6-methyl-3-oxo-1-cyclohexenyl)butanoic acid |
440167 |
(2S,4aR,6aS,6aS,6bR,8aS,10R,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid |
internal high similarity DBLink | Rows returned: 13 | << Back 1 2 3 |
active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|