| 
 | Compound Information | SONAR Target prediction |  | Name: | ENOXOLONE |  | Unique Identifier: | SPE01500990 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 425.327 g/mol |  | X log p: | -0.225  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O |  | Class: | triterpene |  | Source: | derivative |  | Therapeutics: | antitussive, antiinflammatory, antibacterial | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE00202175 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.3654±0.0157685 |  
		| Normalized OD Score: sc h | 0.5546±0.0170468 |  
		| Z-Score: | -19.6469±2.67122 |  
		| p-Value: | 0 |  
		| Z-Factor: | 0.716927 |  
		| Fitness Defect: | INF |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|C3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 21.80 Celcius |  | Date: | 2006-12-19 YYYY-MM-DD |  | Plate CH Control (+): | 0.037825±0.00152 |  | Plate DMSO Control (-): | 0.6482749999999999±0.01557 |  | Plate Z-Factor: | 0.9500 | 
 |  png ps
 pdf
 | 
 
 
	
		| 7314296 | (1R,3aS,4S,5S,7aR)-7a-methyl-1-[(2S)-6-methylheptan-2-yl]-5-[(1R)-1-methyl-4-oxo-1-cyclohex-2-enyl]-1,2, 3,3a,4,5,6,7-octahydroindene-4-carboxylic acid
 |  
		| 11627011 | azanium 10-hydroxy-4a,6a,6b,9,9,12a-hexamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10,11,12,14b-tetradecahydropicene-2-
 carboxylate
 |  
		| 11751767 | (2S,4aS,6aS,6bR,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,1 4b-dodecahydro-1H-picene-2-carboxylic acid
 |  
		| 12193680 | (2S,4aS,6aR,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10 ,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid
 |  
		| 15958448 | n/a |  
 | internal high similarity DBLink  | Rows returned: 13 | 1 2 3 Next >> | 
 
 | active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 |  | 
 
 |