| Compound Information | SONAR Target prediction | | Name: | ENOXOLONE | | Unique Identifier: | SPE01500990 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 425.327 g/mol | | X log p: | -0.225 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | | Class: | triterpene | | Source: | derivative | | Therapeutics: | antitussive, antiinflammatory, antibacterial |
| Species: |
4932 |
| Condition: |
SPE00201185 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4110±0.00360624 |
| Normalized OD Score: sc h |
0.6944±0.00742231 |
| Z-Score: |
-11.3955±0.0615092 |
| p-Value: |
4.95942e-30 |
| Z-Factor: |
0.601021 |
| Fitness Defect: |
67.4763 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|C3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.70 Celcius | | Date: | 2006-12-15 YYYY-MM-DD | | Plate CH Control (+): | 0.0397±0.00161 | | Plate DMSO Control (-): | 0.594±0.02021 | | Plate Z-Factor: | 0.8848 |
| png ps pdf |
| 7314296 |
(1R,3aS,4S,5S,7aR)-7a-methyl-1-[(2S)-6-methylheptan-2-yl]-5-[(1R)-1-methyl-4-oxo-1-cyclohex-2-enyl]-1,2, 3,3a,4,5,6,7-octahydroindene-4-carboxylic acid |
| 11627011 |
azanium 10-hydroxy-4a,6a,6b,9,9,12a-hexamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10,11,12,14b-tetradecahydropicene-2- carboxylate |
| 11751767 |
(2S,4aS,6aS,6bR,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,1 4b-dodecahydro-1H-picene-2-carboxylic acid |
| 12193680 |
(2S,4aS,6aR,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10 ,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid |
| 15958448 |
n/a |
| internal high similarity DBLink | Rows returned: 13 | 1 2 3 Next >> |
| active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|