Compound Information | SONAR Target prediction | Name: | ENOXOLONE | Unique Identifier: | SPE01500990 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 425.327 g/mol | X log p: | -0.225 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | Class: | triterpene | Source: | derivative | Therapeutics: | antitussive, antiinflammatory, antibacterial |
Species: |
4932 |
Condition: |
SPE01500275 |
Replicates: |
2 |
Raw OD Value: r im |
0.6963±0.413516 |
Normalized OD Score: sc h |
1.3393±0.704913 |
Z-Score: |
7.0800±17.0885 |
p-Value: |
0.000000281682 |
Z-Factor: |
-6.19519 |
Fitness Defect: |
15.0825 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.40 Celcius | Date: | 2006-12-22 YYYY-MM-DD | Plate CH Control (+): | 0.03845±0.00242 | Plate DMSO Control (-): | 0.528775±0.03188 | Plate Z-Factor: | 0.7797 |
| png ps pdf |
7099905 |
(4R)-4-[(3R,5S,8S,10S,13R,14S,17S)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoic acid |
7099906 |
(4S)-4-[(3R,5S,8S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoate |
7099907 |
(4S)-4-[(3R,5S,8S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoic acid |
7099908 |
(4R)-4-[(3R,5S,8S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoate |
7099909 |
(4R)-4-[(3R,5S,8S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoic acid |
7314289 |
(1S,3aS,4S,5S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-5-[(1R)-1-methyl-4-oxo-1-cyclohex-2-enyl]-1,2, 3,3a,4,5,6,7-octahydroindene-4-carboxylate |
internal high similarity DBLink | Rows returned: 13 | 1 2 3 Next >> |
active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|