| Compound Information | SONAR Target prediction |  | Name: | 18alpha-GLYCYRRHETINIC ACID |  | Unique Identifier: | SPE01500989  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 425.327 g/mol |  | X log p: | -0.225  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O |  | Class: | triterpene |  | Source: | epimer of aglycone Glycyrrhiza glabra |  | Therapeutics: | antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		PEX11 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7038±0.0066468 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0180±0.00967113 | 
	 
	
		| Z-Score: | 
		1.0303±0.475407 | 
	 
	
		| p-Value: | 
		0.329692 | 
	 
	
		| Z-Factor: | 
		-10.6716 | 
	 
	
		| Fitness Defect: | 
		1.1096 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 18|F5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.30 Celcius |  | Date: | 2007-10-23 YYYY-MM-DD |  | Plate CH Control (+): | 0.03905±0.00221 |  | Plate DMSO Control (-): | 0.6812±0.12284 |  | Plate Z-Factor: | 0.4018 |  
  |  png ps pdf |  
 
 
	
		| 3230 | 
		10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2- carboxylic acid | 
	 
	
		| 10114 | 
		(2S,4aR,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid | 
	 
	
		| 73398 | 
		(2S,4aR,6aS,6aS,6bR,8aS,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid | 
	 
	
		| 111253 | 
		(2S,4aR,6aS,6aS,6bR,8aS,12aS,14bR)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12, 14b-dodecahydropicene-2-carboxylic acid | 
	 
	
		| 112111 | 
		(2R,4aR,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8 a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid | 
	 
	
		| 125828 | 
		(2R,4aR,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10 ,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 13 | 1 2 3 Next >>  |   
 |  active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 |  |   
 
 |