Compound Information | SONAR Target prediction | Name: | 18alpha-GLYCYRRHETINIC ACID | Unique Identifier: | SPE01500989 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 425.327 g/mol | X log p: | -0.225 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | Class: | triterpene | Source: | epimer of aglycone Glycyrrhiza glabra | Therapeutics: | antiinflammatory |
Species: |
4932 |
Condition: |
HHF1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5899±0.00106066 |
Normalized OD Score: sc h |
0.8606±0.00189543 |
Z-Score: |
-6.0633±0.357258 |
p-Value: |
0.0000000032447 |
Z-Factor: |
0.177072 |
Fitness Defect: |
19.5462 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 14|B10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2008-04-15 YYYY-MM-DD | Plate CH Control (+): | 0.0402±0.00060 | Plate DMSO Control (-): | 0.678875±0.02334 | Plate Z-Factor: | 0.8947 |
| png ps pdf |
4293810 |
2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylate |
4609018 |
4-(3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl )pentanoic acid |
5232706 |
2-(4a,8-dimethyl-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-2-yl)propanoic acid |
5283994 |
(4R)-4-[(3R,5R,8S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5283995 |
(4R)-4-[(8R,9S,10R,12S,13R,14S,17R)-12-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodeca hydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5284007 |
(4R)-4-[(3R,5R,10S,13S,14R,17R)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoic acid |
internal high similarity DBLink | Rows returned: 13 | << Back 1 2 3 |
active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|