Compound Information | SONAR Target prediction | Name: | 18alpha-GLYCYRRHETINIC ACID | Unique Identifier: | SPE01500989 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 425.327 g/mol | X log p: | -0.225 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(CCC3(C)CCC21C)C(O)=O | Class: | triterpene | Source: | epimer of aglycone Glycyrrhiza glabra | Therapeutics: | antiinflammatory |
Species: |
4932 |
Condition: |
TPK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5923±0.0358503 |
Normalized OD Score: sc h |
0.8649±0.0249068 |
Z-Score: |
-6.5047±1.09357 |
p-Value: |
0.00000000497852 |
Z-Factor: |
-0.388125 |
Fitness Defect: |
19.1181 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 14|B10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.90 Celcius | Date: | 2008-04-25 YYYY-MM-DD | Plate CH Control (+): | 0.0397±0.00070 | Plate DMSO Control (-): | 0.661675±0.02241 | Plate Z-Factor: | 0.8420 |
| png ps pdf |
7314296 |
(1R,3aS,4S,5S,7aR)-7a-methyl-1-[(2S)-6-methylheptan-2-yl]-5-[(1R)-1-methyl-4-oxo-1-cyclohex-2-enyl]-1,2, 3,3a,4,5,6,7-octahydroindene-4-carboxylic acid |
11627011 |
azanium 10-hydroxy-4a,6a,6b,9,9,12a-hexamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10,11,12,14b-tetradecahydropicene-2- carboxylate |
11751767 |
(2S,4aS,6aS,6bR,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,1 4b-dodecahydro-1H-picene-2-carboxylic acid |
12193680 |
(2S,4aS,6aR,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10 ,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid |
15958448 |
n/a |
internal high similarity DBLink | Rows returned: 13 | << Back 1 2 3 |
active | Cluster 6100 | Additional Members: 5 | Rows returned: 1 | |
|