| Compound Information | SONAR Target prediction |
| Name: | DEHYDROCHOLIC ACID |
| Unique Identifier: | SPE01500907 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C24H34O5 |
| Molecular Weight: | 369.262 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3C(CC(=O)C12C)C1(C)CCC(=O)CC1CC3=O |
| Class: | sterol |
| Source: | derivative of cholic acid |
| Found: 104 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [104] |
| Species: | 4932 |
| Condition: | BCK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.9005±0.00650538 |
| Normalized OD Score: sc h | 0.9999±0.0123611 |
| Z-Score: | -0.4390±0.617463 |
| p-Value: | 0.689674 |
| Z-Factor: | -9.75996 |
| Fitness Defect: | 0.3715 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 7145 | Additional Members: 4 | Rows returned: 2 |
| SPE01500225 | 0.151515151515151 |
| Prest498 | 0 |
Service provided by the
Mike Tyers Laboratory