| Compound Information | SONAR Target prediction |  | Name: | CHOLIC ACID, METHYL ESTER |  | Unique Identifier: | SPE01500904  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 381.272 g/mol |  | X log p: | -0.698  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |  | Class: | sterol |  | Source: | acid as primary bile constituent |  
 
 
	
		| Species: | 
		4896 | 
	 
	
		| Condition: | 
		MT1181-W303mata | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.3734±0.00685894 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9405±0.00178613 | 
	 
	
		| Z-Score: | 
		-0.6049±0.0131033 | 
	 
	
		| p-Value: | 
		0.545232 | 
	 
	
		| Z-Factor: | 
		-2.00896 | 
	 
	
		| Fitness Defect: | 
		0.6065 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 6|C5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.10 Celcius |  | Date: | 2005-12-14 YYYY-MM-DD |  | Plate CH Control (+): | 0.442±0.01796 |  | Plate DMSO Control (-): | 0.38835±0.03811 |  | Plate Z-Factor: | -2.1178 |  
  |  png ps pdf |  
 
 
	
		| 94203 | 
		methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,1 6,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
	
		| 102366 | 
		methyl (4R)-4-[(5S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tet radecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
	
		| 191183 | 
		methyl (4R)-4-[(3S,5R,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
	
		| 277782 | 
		methyl 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phe nanthren-17-yl)pentanoate | 
	 
	
		| 279055 | 
		methyl 8,9-bis(hydroxymethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene- 1-carboxylate | 
	 
	
		| 632807 | 
		methyl 4-(3-hydroxy-7-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]p henanthren-17-yl)pentanoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >>  |   
 |  nonactive | Cluster 10691 | Additional Members: 8 | Rows returned: 4 |  |   
 
 |