| 
 | Compound Information | SONAR Target prediction |  | Name: | CHOLIC ACID, METHYL ESTER |  | Unique Identifier: | SPE01500904 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 381.272 g/mol |  | X log p: | -0.698  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |  | Class: | sterol |  | Source: | acid as primary bile constituent | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPT3 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4843±0.0184555 |  
		| Normalized OD Score: sc h | 0.9647±0.00586103 |  
		| Z-Score: | -0.1049±0.0192118 |  
		| p-Value: | 0.916472 |  
		| Z-Factor: | -2.70542 |  
		| Fitness Defect: | 0.0872 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 16|B9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.90 Celcius |  | Date: | 2008-02-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.041124999999999995±0.00151 |  | Plate DMSO Control (-): | 0.4498±0.01889 |  | Plate Z-Factor: | 0.8542 | 
 |  png ps
 pdf
 | 
 
 
	
		| 94203 | methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,1
 6,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate
 |  
		| 102366 | methyl (4R)-4-[(5S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tet
 radecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate
 |  
		| 191183 | methyl (4R)-4-[(3S,5R,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-
 tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate
 |  
		| 277782 | methyl 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phe
 nanthren-17-yl)pentanoate
 |  
		| 279055 | methyl 8,9-bis(hydroxymethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-
 1-carboxylate
 |  
		| 632807 | methyl 4-(3-hydroxy-7-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]p
 henanthren-17-yl)pentanoate
 |  
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >> | 
 
 | active | Cluster 10691 | Additional Members: 8 | Rows returned: 0 |  | 
 
 |