Compound Information | SONAR Target prediction | Name: | CHOLIC ACID, METHYL ESTER | Unique Identifier: | SPE01500904 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 381.272 g/mol | X log p: | -0.698 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | acid as primary bile constituent |
Species: |
4932 |
Condition: |
BY4741-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.8167±0.0115258 |
Normalized OD Score: sc h |
0.9963±0.00906758 |
Z-Score: |
0.7668±0.331581 |
p-Value: |
0.455586 |
Z-Factor: |
-4.35228 |
Fitness Defect: |
0.7862 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|C5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2006-04-05 YYYY-MM-DD | Plate CH Control (+): | 0.038099999999999995±0.00096 | Plate DMSO Control (-): | 0.7761999999999999±0.01669 | Plate Z-Factor: | 0.9288 |
| png ps pdf |
94203 |
methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,1 6,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
102366 |
methyl (4R)-4-[(5S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tet radecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
191183 |
methyl (4R)-4-[(3S,5R,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
277782 |
methyl 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phe nanthren-17-yl)pentanoate |
279055 |
methyl 8,9-bis(hydroxymethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene- 1-carboxylate |
632807 |
methyl 4-(3-hydroxy-7-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]p henanthren-17-yl)pentanoate |
internal high similarity DBLink | Rows returned: 10 | << Back 1 2 |
active | Cluster 10691 | Additional Members: 8 | Rows returned: 0 | |
|