| Compound Information | SONAR Target prediction | | Name: | CHOLIC ACID, METHYL ESTER | | Unique Identifier: | SPE01500904 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 381.272 g/mol | | X log p: | -0.698 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | | Class: | sterol | | Source: | acid as primary bile constituent |
| Species: |
4932 |
| Condition: |
BEM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4881±0.0066468 |
| Normalized OD Score: sc h |
1.0201±0.000362742 |
| Z-Score: |
1.0556±0.0632116 |
| p-Value: |
0.291612 |
| Z-Factor: |
-1.46702 |
| Fitness Defect: |
1.2323 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 16|B9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.50 Celcius | | Date: | 2008-02-05 YYYY-MM-DD | | Plate CH Control (+): | 0.041874999999999996±0.00069 | | Plate DMSO Control (-): | 0.471825±0.01939 | | Plate Z-Factor: | 0.8434 |
| png ps pdf |
| 94203 |
methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,1 6,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 102366 |
methyl (4R)-4-[(5S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tet radecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 191183 |
methyl (4R)-4-[(3S,5R,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 277782 |
methyl 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phe nanthren-17-yl)pentanoate |
| 279055 |
methyl 8,9-bis(hydroxymethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene- 1-carboxylate |
| 632807 |
methyl 4-(3-hydroxy-7-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]p henanthren-17-yl)pentanoate |
| internal high similarity DBLink | Rows returned: 10 | << Back 1 2 |
| active | Cluster 10691 | Additional Members: 8 | Rows returned: 0 | |
|