| Compound Information | SONAR Target prediction |  | Name: | CHOLIC ACID, METHYL ESTER |  | Unique Identifier: | SPE01500904  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 381.272 g/mol |  | X log p: | -0.698  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |  | Class: | sterol |  | Source: | acid as primary bile constituent |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RIC1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6566±0.00537401 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0785±0.0115734 | 
	 
	
		| Z-Score: | 
		1.7020±0.00474896 | 
	 
	
		| p-Value: | 
		0.0887584 | 
	 
	
		| Z-Factor: | 
		-0.688897 | 
	 
	
		| Fitness Defect: | 
		2.4218 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 6|C5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.50 Celcius |  | Date: | 2006-03-18 YYYY-MM-DD |  | Plate CH Control (+): | 0.0393±0.00199 |  | Plate DMSO Control (-): | 0.56915±0.02296 |  | Plate Z-Factor: | 0.9014 |  
  |  png ps pdf |  
 
 
	
		| 6553919 | 
		methyl (4S)-4-[(3R,5R,7S,8R,9R,10R,12S,13S,14S,17S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
	
		| 6571713 | 
		methyl (4S)-4-[(3S,5S,7R,8S,9S,10R,12R,13S,14R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
	
		| 6708657 | 
		methyl 4-[(3R,5S,7R,10S,12S,13R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetrade cahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >>  |   
 |  active | Cluster 10691 | Additional Members: 8 | Rows returned: 0 |  |  
  
 |