| Compound Information | SONAR Target prediction | | Name: | CHOLIC ACID, METHYL ESTER | | Unique Identifier: | SPE01500904 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 381.272 g/mol | | X log p: | -0.698 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | | Class: | sterol | | Source: | acid as primary bile constituent |
| Species: |
4932 |
| Condition: |
KGD1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7270±0.00452548 |
| Normalized OD Score: sc h |
1.0282±0.00307325 |
| Z-Score: |
1.6565±0.204767 |
| p-Value: |
0.101138 |
| Z-Factor: |
-4.56376 |
| Fitness Defect: |
2.2913 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|C5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.90 Celcius | | Date: | 2007-09-11 YYYY-MM-DD | | Plate CH Control (+): | 0.039925±0.00063 | | Plate DMSO Control (-): | 0.697775±0.05217 | | Plate Z-Factor: | 0.7691 |
| png ps pdf |
| 632808 |
methyl 4-(7-hydroxy-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]p henanthren-17-yl)pentanoate |
| 632846 |
methyl 4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenant hren-17-yl)pentanoate |
| 634377 |
methyl 6-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenant hren-17-yl)-2-methyl-heptanoate |
| 637626 |
methyl (4S)-4-[(3S,5R,7S,8R,9S,10S,12S,13R,14S,17S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 2738132 |
methyl 4-[(3R,7R,10S,12S,13R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecah ydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 3444423 |
methyl 3-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phe nanthren-17-yl)butanoate |
| internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
| active | Cluster 10691 | Additional Members: 8 | Rows returned: 0 | |
|