| Compound Information | SONAR Target prediction |  | Name: | PIPERINE |  | Unique Identifier: | SPE01500873  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 266.187 g/mol |  | X log p: | 14.992  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 38.77 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | O=C(C=CC=Cc1ccc2OCOc2c1)N1CCCCC1 |  | Class: | alkaloid |  | Source: | black pepper (Piper nigrum L.) |  | Reference: | Tet Lett 1979: 1043 |  | Therapeutics: | analeptic, antibacterial |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MCK1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4322±0.00572756 | 
	 
	
		| Normalized OD Score: sc h | 
		0.7288±0.00501498 | 
	 
	
		| Z-Score: | 
		-11.5532±1.11717 | 
	 
	
		| p-Value: | 
		2.56696e-27 | 
	 
	
		| Z-Factor: | 
		-1.7689 | 
	 
	
		| Fitness Defect: | 
		61.2271 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 19|F5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.60 Celcius |  | Date: | 2007-11-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.038825±0.00202 |  | Plate DMSO Control (-): | 0.578825±0.11216 |  | Plate Z-Factor: | 0.3232 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 4 |  |  
 
	
		| 4840 | 
		5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one | 
	 
	
		| 638024 | 
		(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one | 
	 
	
		| 1548912 | 
		(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one | 
	 
	
		| 1548913 | 
		(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  nonactive | Cluster 14706 | Additional Members: 7 | Rows returned: 1 |  |   
 
 |