| Compound Information | SONAR Target prediction | | Name: | PIPERINE | | Unique Identifier: | SPE01500873 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 266.187 g/mol | | X log p: | 14.992 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 38.77 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | O=C(C=CC=Cc1ccc2OCOc2c1)N1CCCCC1 | | Class: | alkaloid | | Source: | black pepper (Piper nigrum L.) | | Reference: | Tet Lett 1979: 1043 | | Therapeutics: | analeptic, antibacterial |
| Species: |
4932 |
| Condition: |
SPT3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3470±0.0658316 |
| Normalized OD Score: sc h |
0.5990±0.0984651 |
| Z-Score: |
-6.3766±1.42484 |
| p-Value: |
0.0000000395766 |
| Z-Factor: |
-0.0566031 |
| Fitness Defect: |
17.045 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 4|C10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.30 Celcius | | Date: | 2008-02-13 YYYY-MM-DD | | Plate CH Control (+): | 0.041±0.00084 | | Plate DMSO Control (-): | 0.54965±0.02306 | | Plate Z-Factor: | 0.8696 |
|  png
ps
pdf |
| DBLink | Rows returned: 4 | |
| 4840 |
5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
| 638024 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
| 1548912 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
| 1548913 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
| internal high similarity DBLink | Rows returned: 1 | |
| nonactive | Cluster 14706 | Additional Members: 7 | Rows returned: 1 | |
|
