| 
 | Compound Information | SONAR Target prediction |  | Name: | PIPERINE |  | Unique Identifier: | SPE01500873 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 266.187 g/mol |  | X log p: | 14.992  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 38.77 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | O=C(C=CC=Cc1ccc2OCOc2c1)N1CCCCC1 |  | Class: | alkaloid |  | Source: | black pepper (Piper nigrum L.) |  | Reference: | Tet Lett 1979: 1043 |  | Therapeutics: | analeptic, antibacterial | 
 
 
	
		| Species: | 4932 |  
		| Condition: | MSN5 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6544±0.00876812 |  
		| Normalized OD Score: sc h | 0.9596±0.00973484 |  
		| Z-Score: | -1.9637±0.372321 |  
		| p-Value: | 0.057505 |  
		| Z-Factor: | -1.6457 |  
		| Fitness Defect: | 2.8559 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 4|C10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.50 Celcius |  | Date: | 2008-02-29 YYYY-MM-DD |  | Plate CH Control (+): | 0.040575±0.00054 |  | Plate DMSO Control (-): | 0.6627000000000001±0.01383 |  | Plate Z-Factor: | 0.9393 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 4 |  | 
 
	
		| 4840 | 5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |  
		| 638024 | (2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |  
		| 1548912 | (2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |  
		| 1548913 | (2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 14706 | Additional Members: 7 | Rows returned: 1 |  | 
 
 |