Compound Information | SONAR Target prediction | Name: | PIPERINE | Unique Identifier: | SPE01500873 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 266.187 g/mol | X log p: | 14.992 (online calculus) | Lipinksi Failures | 1 | TPSA | 38.77 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | O=C(C=CC=Cc1ccc2OCOc2c1)N1CCCCC1 | Class: | alkaloid | Source: | black pepper (Piper nigrum L.) | Reference: | Tet Lett 1979: 1043 | Therapeutics: | analeptic, antibacterial |
Species: |
4932 |
Condition: |
SPE01500811 |
Replicates: |
2 |
Raw OD Value: r im |
0.6719±0.0190212 |
Normalized OD Score: sc h |
1.0334±0.0322244 |
Z-Score: |
1.4007±1.30187 |
p-Value: |
0.325716 |
Z-Factor: |
-14.6492 |
Fitness Defect: |
1.1217 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|B10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2007-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.040275000000000005±0.00165 | Plate DMSO Control (-): | 0.681475±0.02649 | Plate Z-Factor: | 0.8597 |
| png ps pdf |
DBLink | Rows returned: 4 | |
4840 |
5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
638024 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
1548912 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
1548913 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 14706 | Additional Members: 7 | Rows returned: 1 | |
|