| Compound Information | SONAR Target prediction | | Name: | CHOL-11-ENIC ACID | | Unique Identifier: | SPE01500856 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24H36O3 | | Molecular Weight: | 337.263 g/mol | | X log p: | 4.247 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3CCC4CC(=O)CCC4(C)C3C=CC12C | | Generic_name: | OLEIC ACID | | Chemical_iupac_name: | OLEIC ACID | | Drug_type: | Experimental | | Kegg_compound_id: | C00712 | | Drugbank_id: | EXPT02430 | | Logp: | 6.036 | | Cas_registry_number: | 112-80-1 | | Drug_category: | Serum Albumin inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
GPR1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6619±0.0443356 |
| Normalized OD Score: sc h |
0.8319±0.0161984 |
| Z-Score: |
-4.7506±0.16438 |
| p-Value: |
0.00000235662 |
| Z-Factor: |
-0.377468 |
| Fitness Defect: |
12.9583 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|E4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.50 Celcius | | Date: | 2006-03-02 YYYY-MM-DD | | Plate CH Control (+): | 0.038575±0.00080 | | Plate DMSO Control (-): | 0.7821499999999999±0.04082 | | Plate Z-Factor: | 0.9403 |
| png ps pdf |
| 346770 |
n/a |
| 441446 |
13-[(1S)-1-cyclopent-2-enyl]tridecanoic acid |
| 445586 |
(8E,14E)-icosa-8,14-dienoic acid |
| 445589 |
9-[(1R,6S)-1,3-dimethyl-2-bicyclo[4.1.0]hept-2-enyl]-3,7-dimethyl-nonanoic acid |
| 445638 |
(E)-hexadec-9-enoic acid |
| 445639 |
(E)-octadec-9-enoic acid |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 15990 | Additional Members: 2 | Rows returned: 1 | |
|