| Compound Information | SONAR Target prediction | | Name: | CHOL-11-ENIC ACID | | Unique Identifier: | SPE01500856 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24H36O3 | | Molecular Weight: | 337.263 g/mol | | X log p: | 4.247 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3CCC4CC(=O)CCC4(C)C3C=CC12C | | Generic_name: | OLEIC ACID | | Chemical_iupac_name: | OLEIC ACID | | Drug_type: | Experimental | | Kegg_compound_id: | C00712 | | Drugbank_id: | EXPT02430 | | Logp: | 6.036 | | Cas_registry_number: | 112-80-1 | | Drug_category: | Serum Albumin inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
APC9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7219±0.00459619 |
| Normalized OD Score: sc h |
1.0310±0.000565933 |
| Z-Score: |
1.6858±0.0561622 |
| p-Value: |
0.092092 |
| Z-Factor: |
-1.89692 |
| Fitness Defect: |
2.385 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|E4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.00 Celcius | | Date: | 2007-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.041675000000000004±0.00068 | | Plate DMSO Control (-): | 0.6857500000000001±0.02249 | | Plate Z-Factor: | 0.8773 |
|  png
ps
pdf |
| 7056807 |
(4S)-4-[(5S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent
a[a]phenanthren-17-yl]pentanoate |
| 7056808 |
(4S)-4-[(5S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent
a[a]phenanthren-17-yl]pentanoic acid |
| 7056809 |
(4S)-4-[(5S,8S,9R,10R,13R,14R,17S)-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent
a[a]phenanthren-17-yl]pentanoate |
| 7056810 |
(4S)-4-[(5S,8S,9R,10R,13R,14R,17S)-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent
a[a]phenanthren-17-yl]pentanoic acid |
| 7056811 |
(4S)-4-[(5S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent
a[a]phenanthren-17-yl]pentanoate |
| 7056812 |
(4S)-4-[(5S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent
a[a]phenanthren-17-yl]pentanoic acid |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 15990 | Additional Members: 2 | Rows returned: 1 | |
|
