Compound Information | SONAR Target prediction | Name: | CHOL-11-ENIC ACID | Unique Identifier: | SPE01500856 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C24H36O3 | Molecular Weight: | 337.263 g/mol | X log p: | 4.247 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3CCC4CC(=O)CCC4(C)C3C=CC12C | Generic_name: | OLEIC ACID | Chemical_iupac_name: | OLEIC ACID | Drug_type: | Experimental | Kegg_compound_id: | C00712 | Drugbank_id: | EXPT02430 | Logp: | 6.036 | Cas_registry_number: | 112-80-1 | Drug_category: | Serum Albumin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.7219±0.00459619 |
Normalized OD Score: sc h |
1.0310±0.000565933 |
Z-Score: |
1.6858±0.0561622 |
p-Value: |
0.092092 |
Z-Factor: |
-1.89692 |
Fitness Defect: |
2.385 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|E4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.00 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.041675000000000004±0.00068 | Plate DMSO Control (-): | 0.6857500000000001±0.02249 | Plate Z-Factor: | 0.8773 |
| png ps pdf |
6439027 |
(9E,15E)-octadeca-9,15-dienoic acid |
6440850 |
cobalt(+2) cation; (E)-octadec-9-enoic acid |
6441271 |
barium(+2) cation; (E)-octadec-9-enoate |
6441289 |
(E)-octadec-9-enoic acid |
6441306 |
lithium (E)-octadec-9-enoate |
6441308 |
(E)-octadec-9-enoate; tin(+4) cation |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 15990 | Additional Members: 2 | Rows returned: 1 | |
|