| Compound Information | SONAR Target prediction | | Name: | CHOL-11-ENIC ACID | | Unique Identifier: | SPE01500856 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24H36O3 | | Molecular Weight: | 337.263 g/mol | | X log p: | 4.247 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3CCC4CC(=O)CCC4(C)C3C=CC12C | | Generic_name: | OLEIC ACID | | Chemical_iupac_name: | OLEIC ACID | | Drug_type: | Experimental | | Kegg_compound_id: | C00712 | | Drugbank_id: | EXPT02430 | | Logp: | 6.036 | | Cas_registry_number: | 112-80-1 | | Drug_category: | Serum Albumin inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
MRT4 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4979±0.0448306 |
| Normalized OD Score: sc h |
0.8088±0.00166513 |
| Z-Score: |
-6.3545±0.979435 |
| p-Value: |
0.00000000748408 |
| Z-Factor: |
-0.263785 |
| Fitness Defect: |
18.7105 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|E4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2007-08-30 YYYY-MM-DD | | Plate CH Control (+): | 0.039874999999999994±0.00238 | | Plate DMSO Control (-): | 0.5941000000000001±0.04362 | | Plate Z-Factor: | 0.7386 |
| png ps pdf |
| 5284022 |
(4R)-4-[(5S,9R,10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phen anthren-17-yl]pentanoic acid |
| 5284049 |
(4R)-4-[(5R,8R,9S,10S,13R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,16,17-dodecahydrocyclopenta[a] phenanthren-17-yl]pentanoic acid |
| 5284122 |
(4R)-4-[(5R,9R,10R,13R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,9,11,12,15,16,17-dodecahydrocyclopenta[a]ph enanthren-17-yl]pentanoic acid |
| 5284434 |
sodium (E)-octadec-9-enoate |
| 5312300 |
(E)-7-methylhexadec-6-enoic acid |
| 5312301 |
(E)-14-methylhexadec-8-enoic acid |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 15990 | Additional Members: 2 | Rows returned: 1 | |
|