Compound Information | SONAR Target prediction | Name: | 7-OXOCHOLESTEROL | Unique Identifier: | SPE01500854 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 356.288 g/mol | X log p: | 2.056 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3C(CCC12C)C1(C)CCC(O)CC1=CC3=O | Class: | sterol | Source: | Cliona copiosa | Reference: | Annalen 543, 240 (1940); JACS 71:2226 (1949); J Chem Soc 1956:1740; 1968:981; Lipids 3:551 (1968); J Nat Prod 55:1588 (1992) |
Species: |
4932 |
Condition: |
SRS2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7117±0.000565685 |
Normalized OD Score: sc h |
0.9959±0.000165624 |
Z-Score: |
-0.2045±0.00896699 |
p-Value: |
0.837972 |
Z-Factor: |
-12.5868 |
Fitness Defect: |
0.1768 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 22|A7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.30 Celcius | Date: | 2008-01-22 YYYY-MM-DD | Plate CH Control (+): | 0.042225±0.00052 | Plate DMSO Control (-): | 0.6784250000000001±0.01655 | Plate Z-Factor: | 0.9217 |
| png ps pdf |
334 |
7-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a] phenanthren-3-one |
91474 |
(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,1 5,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
123743 |
(7R,8S,9S,10R,13R,14S,17R)-7-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,1 5,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
134972 |
(3S,8S,9S,10R,13R,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydroc yclopenta[a]phenanthren-7-one |
152934 |
(8S,9S,10R,13R,14S,17S)-17-acetyl-7-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocycl openta[a]phenanthren-3-one |
160608 |
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,8, 9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
internal high similarity DBLink | Rows returned: 0 | |
|