| Compound Information | SONAR Target prediction | | Name: | 7-OXOCHOLESTEROL | | Unique Identifier: | SPE01500854 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 356.288 g/mol | | X log p: | 2.056 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3C(CCC12C)C1(C)CCC(O)CC1=CC3=O | | Class: | sterol | | Source: | Cliona copiosa | | Reference: | Annalen 543, 240 (1940); JACS 71:2226 (1949); J Chem Soc 1956:1740; 1968:981; Lipids 3:551 (1968); J Nat Prod 55:1588 (1992) |
| Species: |
4932 |
| Condition: |
TFP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7493±0.00905097 |
| Normalized OD Score: sc h |
1.0442±0.00888442 |
| Z-Score: |
1.8455±0.345441 |
| p-Value: |
0.0729884 |
| Z-Factor: |
-4.52173 |
| Fitness Defect: |
2.6175 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|D7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.90 Celcius | | Date: | 2007-08-31 YYYY-MM-DD | | Plate CH Control (+): | 0.04095±0.00127 | | Plate DMSO Control (-): | 0.694075±0.06928 | | Plate Z-Factor: | 0.6395 |
| png ps pdf |
| 6914805 |
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5S)-5-ethyl-6-methyl-heptan-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,8, 9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
| 11175416 |
(7R,8S,9S,10R,13R,14S,17R)-7-hydroxy-17-[(2R)-1-hydroxypropan-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14, 15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| 12044013 |
(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2S,5S)-5-ethyl-6-methyl-hept-3-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3 ,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
| 15955968 |
(3S,10R,13R,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-do decahydrocyclopenta[a]phenanthren-7-one |
| 15984870 |
n/a |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 17506 | Additional Members: 20 | Rows returned: 4 | |
|