| Compound Information | SONAR Target prediction |  | Name: | 7-OXOCHOLESTEROL |  | Unique Identifier: | SPE01500854  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 356.288 g/mol |  | X log p: | 2.056  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3C(CCC12C)C1(C)CCC(O)CC1=CC3=O |  | Class: | sterol |  | Source: | Cliona copiosa |  | Reference: | Annalen 543, 240 (1940); JACS 71:2226 (1949); J Chem Soc 1956:1740; 1968:981; Lipids 3:551 (1968); J Nat Prod 55:1588 (1992) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		VPS1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6600±0.0229103 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0452±0.0391572 | 
	 
	
		| Z-Score: | 
		1.7652±1.49331 | 
	 
	
		| p-Value: | 
		0.241478 | 
	 
	
		| Z-Factor: | 
		-4.31143 | 
	 
	
		| Fitness Defect: | 
		1.421 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 6|D7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.50 Celcius |  | Date: | 2007-10-03 YYYY-MM-DD |  | Plate CH Control (+): | 0.0399±0.00052 |  | Plate DMSO Control (-): | 0.630725±0.04100 |  | Plate Z-Factor: | 0.7858 |  
  |  png ps pdf |  
 
 
	
		| 193396 | 
		(7R,8S,9S,10R,13R,14S,17R)-7-hydroxy-17-[(2R)-7-hydroxy-6-methyl-heptan-2-yl]-10,13-dimethyl-1,2,6,7,8,9 ,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one | 
	 
	
		| 287664 | 
		3-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a] phenanthren-7-one | 
	 
	
		| 440681 | 
		(7R)-7-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopen ta[a]phenanthren-3-one | 
	 
	
		| 510082 | 
		(3S,10R,13R,17R)-17-[(2R,5S)-5-ethyl-6-methyl-heptan-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14 ,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one | 
	 
	
		| 630242 | 
		17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-o ne | 
	 
	
		| 3247054 | 
		(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6,7,7,7-tetradeuterio-6-methyl-heptan-2-yl] -1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 17506 | Additional Members: 20 | Rows returned: 4 |  |   
 
 |