| 
 | Compound Information | SONAR Target prediction |  | Name: | 7-OXOCHOLESTEROL |  | Unique Identifier: | SPE01500854 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 356.288 g/mol |  | X log p: | 2.056  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3C(CCC12C)C1(C)CCC(O)CC1=CC3=O |  | Class: | sterol |  | Source: | Cliona copiosa |  | Reference: | Annalen 543, 240 (1940); JACS 71:2226 (1949); J Chem Soc 1956:1740; 1968:981; Lipids 3:551 (1968); J Nat Prod 55:1588 (1992)
 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | MMS22 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5016±0.0135057 |  
		| Normalized OD Score: sc h | 1.0339±0.0192378 |  
		| Z-Score: | 1.1581±0.665267 |  
		| p-Value: | 0.297544 |  
		| Z-Factor: | -5.05039 |  
		| Fitness Defect: | 1.2122 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 22|A7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.00 Celcius |  | Date: | 2008-06-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.040825±0.00055 |  | Plate DMSO Control (-): | 0.49534999999999996±0.02369 |  | Plate Z-Factor: | 0.8388 | 
 |  png ps
 pdf
 | 
 
 
	
		| 334 | 7-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a] phenanthren-3-one
 |  
		| 91474 | (3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,1 5,16,17-dodecahydrocyclopenta[a]phenanthren-7-one
 |  
		| 123743 | (7R,8S,9S,10R,13R,14S,17R)-7-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,1 5,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
 |  
		| 134972 | (3S,8S,9S,10R,13R,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydroc yclopenta[a]phenanthren-7-one
 |  
		| 152934 | (8S,9S,10R,13R,14S,17S)-17-acetyl-7-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocycl openta[a]phenanthren-3-one
 |  
		| 160608 | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,8, 9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 17506 | Additional Members: 20 | Rows returned: 4 |  | 
 
 |