| 
 | Compound Information | SONAR Target prediction |  | Name: | CARYOPHYLLENE [t(-)] |  | Unique Identifier: | SPE01500842 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 168.15 g/mol |  | X log p: | 3.322  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 0 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=C)CC=1 |  | Class: | sesquiterpene |  | Source: | clove, cinnamon and many other oils | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SEC22 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6444±0.0066468 |  
		| Normalized OD Score: sc h | 1.0217±0.0036777 |  
		| Z-Score: | 0.7514±0.0922348 |  
		| p-Value: | 0.453368 |  
		| Z-Factor: | -4.42596 |  
		| Fitness Defect: | 0.7911 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 6|D2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.60 Celcius |  | Date: | 2007-10-16 YYYY-MM-DD |  | Plate CH Control (+): | 0.039975±0.00284 |  | Plate DMSO Control (-): | 0.619425±0.03724 |  | Plate Z-Factor: | 0.8048 | 
 |  png ps
 pdf
 | 
 
 
	
		| 10354 | 1-methyl-3-prop-1-en-2-yl-cyclohexene |  
		| 41683 | undeca-1,4-diene |  
		| 55569 | 5-methyl-3-prop-1-en-2-yl-cyclohexene |  
		| 90805 | 1,4-dimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroazulene |  
		| 138919 | n/a |  
		| 138952 | bicyclo[3.2.2]nona-6,9-diene |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 8140 | Additional Members: 2 | Rows returned: 0 |  | 
 
 |