Compound Information | SONAR Target prediction | Name: | CARYOPHYLLENE [t(-)] | Unique Identifier: | SPE01500842 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 168.15 g/mol | X log p: | 3.322 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 0 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=C)CC=1 | Class: | sesquiterpene | Source: | clove, cinnamon and many other oils |
Species: |
4932 |
Condition: |
HXK2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7444±0.000848528 |
Normalized OD Score: sc h |
0.9815±0.00100181 |
Z-Score: |
-0.8283±0.0287727 |
p-Value: |
0.407606 |
Z-Factor: |
-2.2175 |
Fitness Defect: |
0.8975 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 22|A2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.20 Celcius | Date: | 2008-03-05 YYYY-MM-DD | Plate CH Control (+): | 0.041374999999999995±0.00110 | Plate DMSO Control (-): | 0.739075±0.01758 | Plate Z-Factor: | 0.9097 |
| png ps pdf |
10354 |
1-methyl-3-prop-1-en-2-yl-cyclohexene |
41683 |
undeca-1,4-diene |
55569 |
5-methyl-3-prop-1-en-2-yl-cyclohexene |
90805 |
1,4-dimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroazulene |
138919 |
n/a |
138952 |
bicyclo[3.2.2]nona-6,9-diene |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 0 | |
|