| Compound Information | SONAR Target prediction |  | Name: | CARYOPHYLLENE [t(-)] |  | Unique Identifier: | SPE01500842  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 168.15 g/mol |  | X log p: | 3.322  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 0 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=C)CC=1 |  | Class: | sesquiterpene |  | Source: | clove, cinnamon and many other oils |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		GCN3 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6445±0.0116673 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9792±0.00171423 | 
	 
	
		| Z-Score: | 
		-1.0128±0.0816596 | 
	 
	
		| p-Value: | 
		0.31197 | 
	 
	
		| Z-Factor: | 
		-2.88233 | 
	 
	
		| Fitness Defect: | 
		1.1648 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 22|A2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.10 Celcius |  | Date: | 2007-12-11 YYYY-MM-DD |  | Plate CH Control (+): | 0.043625±0.00115 |  | Plate DMSO Control (-): | 0.651725±0.01651 |  | Plate Z-Factor: | 0.9127 |  
  |  png ps pdf |  
 
 
	
		| 10354 | 
		1-methyl-3-prop-1-en-2-yl-cyclohexene | 
	 
	
		| 41683 | 
		undeca-1,4-diene | 
	 
	
		| 55569 | 
		5-methyl-3-prop-1-en-2-yl-cyclohexene | 
	 
	
		| 90805 | 
		1,4-dimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroazulene | 
	 
	
		| 138919 | 
		n/a | 
	 
	
		| 138952 | 
		bicyclo[3.2.2]nona-6,9-diene | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 8140 | Additional Members: 2 | Rows returned: 0 |  |  
  
 |