| Compound Information | SONAR Target prediction | | Name: | CARYOPHYLLENE [t(-)] | | Unique Identifier: | SPE01500842 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 168.15 g/mol | | X log p: | 3.322 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 0 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=C)CC=1 | | Class: | sesquiterpene | | Source: | clove, cinnamon and many other oils |
| Species: |
4932 |
| Condition: |
APC9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7055±0.0111016 |
| Normalized OD Score: sc h |
1.0260±0.0128345 |
| Z-Score: |
1.4095±0.675996 |
| p-Value: |
0.205348 |
| Z-Factor: |
-3.20219 |
| Fitness Defect: |
1.583 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|D2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.90 Celcius | | Date: | 2007-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.042225±0.00072 | | Plate DMSO Control (-): | 0.688175±0.02109 | | Plate Z-Factor: | 0.8974 |
| png ps pdf |
| 139483 |
1-prop-2-enylcyclohexene |
| 144201 |
n/a |
| 145094 |
n/a |
| 145447 |
n/a |
| 316584 |
penta-1,4-dienylcyclohexane |
| 440909 |
(4aS,4bR,7S,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 8140 | Additional Members: 2 | Rows returned: 0 | |
|