Compound Information | SONAR Target prediction | Name: | CHOLIC ACID | Unique Identifier: | SPE01500840 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 369.262 g/mol | X log p: | -1.532 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | mammalian bile | Reference: | Biochem J 85: 236 (1962) | Generic_name: | CHOLIC ACID | Chemical_iupac_name: | CHOLIC ACID | Drug_type: | Experimental | Kegg_compound_id: | C00695 | Drugbank_id: | EXPT00906 | Logp: | 2.818 | Cas_registry_number: | 81-25-4 | Drug_category: | Estrogen-Related Receptor Gamma inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
IKI3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6626±0.00537401 |
Normalized OD Score: sc h |
0.9906±0.00292471 |
Z-Score: |
-0.4619±0.116519 |
p-Value: |
0.645284 |
Z-Factor: |
-8.44997 |
Fitness Defect: |
0.4381 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 16|D8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2008-06-12 YYYY-MM-DD | Plate CH Control (+): | 0.0412±0.00067 | Plate DMSO Control (-): | 0.642425±0.01884 | Plate Z-Factor: | 0.8798 |
| png ps pdf |
303 |
4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phe nanthren-17-yl)pentanoic acid |
2705 |
4-(5,8-dihydroxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl)pent anoic acid |
5645 |
4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenant hren-17-yl)pentanoic acid |
6676 |
4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16, 17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
9680 |
sodium 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phe nanthren-17-yl)pentanoate |
10133 |
(4R)-4-[(3R,5S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
internal high similarity DBLink | Rows returned: 31 | 1 2 3 4 5 6 Next >> |
active | Cluster 10691 | Additional Members: 8 | Rows returned: 0 | |
|