Compound Information | SONAR Target prediction | Name: | CHOLIC ACID | Unique Identifier: | SPE01500840 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 369.262 g/mol | X log p: | -1.532 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | mammalian bile | Reference: | Biochem J 85: 236 (1962) | Generic_name: | CHOLIC ACID | Chemical_iupac_name: | CHOLIC ACID | Drug_type: | Experimental | Kegg_compound_id: | C00695 | Drugbank_id: | EXPT00906 | Logp: | 2.818 | Cas_registry_number: | 81-25-4 | Drug_category: | Estrogen-Related Receptor Gamma inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
TPK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7143±0.00417193 |
Normalized OD Score: sc h |
1.0559±0.0294178 |
Z-Score: |
2.7064±1.44645 |
p-Value: |
0.0462292 |
Z-Factor: |
-2.57835 |
Fitness Defect: |
3.0741 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 16|D8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2008-04-25 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00288 | Plate DMSO Control (-): | 0.6609±0.02185 | Plate Z-Factor: | 0.8948 |
| png ps pdf |
5702181 |
(4R)-4-[(3R,5S,7R,10R,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecah ydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
6331440 |
(4R)-4-[(3R,5S,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid; sodium |
6419977 |
(4R)-4-[(5S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetrad ecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
6546959 |
(4S)-4-[(3R,5R,7S,8R,9R,10R,12S,13S,14S,17S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
6553610 |
(4S)-4-[(3R,5R,7S,8S,9R,10S,13S,14S,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
6570223 |
(4S)-4-[(3S,5S,7R,8S,9S,10R,12R,13S,14R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
internal high similarity DBLink | Rows returned: 31 | 1 2 3 4 5 6 Next >> |
active | Cluster 10691 | Additional Members: 8 | Rows returned: 0 | |
|