| Compound Information | SONAR Target prediction |
| Name: | |
| Unique Identifier: | SPE01500838 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 340.288 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC(C)CCCC(C)C1CCC2C(CCCC12C)=CC=C1CC(O)CCC1=C |
| Found: 2 active | as graph: single | with analogs | 1 2 Next >> |
| Species: | 4932 |
| Condition: | HOG1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6135±0.0403051 |
| Normalized OD Score: sc h | 0.8426±0.00253185 |
| Z-Score: | -4.3446±0.792195 |
| p-Value: | 0.0000775076 |
| Z-Factor: | 0.640333 |
| Fitness Defect: | 9.4651 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory