Compound Information | SONAR Target prediction | Name: | CHENODIOL | Unique Identifier: | SPE01500837 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 353.262 g/mol | X log p: | -0.613 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C | Class: | sterol | Source: | human bile | Reference: | Helv Chim Acta 43: 1595 (1960) | Therapeutics: | anticholithogenic, antilipemic agent | Generic_name: | CHOLIC ACID | Chemical_iupac_name: | CHOLIC ACID | Drug_type: | Experimental | Kegg_compound_id: | C00695 | Drugbank_id: | EXPT00906 | Logp: | 2.818 | Cas_registry_number: | 81-25-4 | Drug_category: | Estrogen-Related Receptor Gamma inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
PEX11 |
Replicates: |
2 |
Raw OD Value: r im |
0.7383±0.00749533 |
Normalized OD Score: sc h |
1.0703±0.0122467 |
Z-Score: |
4.0778±0.364748 |
p-Value: |
0.0000740224 |
Z-Factor: |
-0.983637 |
Fitness Defect: |
9.5111 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|C7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.20 Celcius | Date: | 2007-10-23 YYYY-MM-DD | Plate CH Control (+): | 0.038925±0.00068 | Plate DMSO Control (-): | 0.68025±0.02406 | Plate Z-Factor: | 0.8720 |
| png ps pdf |
7092938 |
(4R)-4-[(3R,5R,7R,8R,9R,10R,13R,14R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
7092939 |
(4R)-4-[(3R,5R,7R,8R,9R,10R,13R,14R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
7092940 |
(4R)-4-[(3R,5R,7R,8R,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
7092941 |
(4R)-4-[(3R,5R,7R,8R,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
7092942 |
(4R)-4-[(3R,5R,7R,8R,9S,10R,13R,14R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
7092943 |
(4R)-4-[(3R,5R,7R,8R,9S,10R,13R,14R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
internal high similarity DBLink | Rows returned: 31 | << Back 1 2 3 4 5 6 |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|