| Compound Information | SONAR Target prediction |
| Name: | BERBERINE CHLORIDE |
| Unique Identifier: | SPE01500811 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 353.671 g/mol |
| X log p: | 15.013 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 39.93 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | [ClH-].COc1ccc2cc3c4cc5OCOc5cc4CC[n+]3cc2c1OC |
| Class: | alkaloid |
| Source: | Berberis and Mahonia spp |
| Reference: | Coll Czech Chem Comm 35:124 (1970); J Nat Prod 40:384 (1977); Agents Actions 14:401
(1984); Alkaloids 28:78 (1986); Life Sci 49:315 (1991); J Cardiovasc P |
| Therapeutics: | antiarrhythmic, alpha2 agonist, cholinesterase, anticonvulsant, antiinflammatory,
antibacterial, antifungal, anti |
| Generic_name: | BERBERINE |
| Chemical_iupac_name: | BERBERINE |
| Drug_type: | Experimental |
| Kegg_compound_id: | C00757 |
| Drugbank_id: | EXPT00672 |
| Logp: | 4.473 |
| Cas_registry_number: | 2086-83-1 |
| Drug_category: | Hypothetical Transcriptional Regulator In Qa inhibitor |
| Organisms_affected: | -1 |
