Compound Information | SONAR Target prediction | Name: | NARINGENIN | Unique Identifier: | SPE01500746 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 260.158 g/mol | X log p: | 12.698 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc(cc1)C1CC(=O)c2c(O)cc(O)cc2O1 | Class: | flavan | Source: | widely distributed in plants | Therapeutics: | antiulcer, gibberellin antagonist | Generic_name: | NARINGENIN | Chemical_iupac_name: | NARINGENIN | Drug_type: | Experimental | Kegg_compound_id: | C00509 | Drugbank_id: | EXPT02295 | Logp: | 2.211 | Cas_registry_number: | 480-41-1 | Drug_category: | Chalcone-Flavonone Isomerase 1 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
NUP100 |
Replicates: |
2 |
Raw OD Value: r im |
0.7250±0.0175362 |
Normalized OD Score: sc h |
0.9984±0.000149828 |
Z-Score: |
-0.1079±0.00940928 |
p-Value: |
0.914068 |
Z-Factor: |
-18.8391 |
Fitness Defect: |
0.0899 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 19|D3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.60 Celcius | Date: | 2007-08-28 YYYY-MM-DD | Plate CH Control (+): | 0.04085±0.00086 | Plate DMSO Control (-): | 0.7100250000000001±0.12253 | Plate Z-Factor: | 0.4268 |
| png ps pdf |
DBLink | Rows returned: 3 | |
932 |
5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
439246 |
(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
667495 |
(2R)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
internal high similarity DBLink | Rows returned: 13 | << Back 1 2 3 |
active | Cluster 14672 | Additional Members: 12 | Rows returned: 1 | |
|