| Compound Information | SONAR Target prediction | | Name: | NARINGENIN | | Unique Identifier: | SPE01500746 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 260.158 g/mol | | X log p: | 12.698 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc(cc1)C1CC(=O)c2c(O)cc(O)cc2O1 | | Class: | flavan | | Source: | widely distributed in plants | | Therapeutics: | antiulcer, gibberellin antagonist | | Generic_name: | NARINGENIN | | Chemical_iupac_name: | NARINGENIN | | Drug_type: | Experimental | | Kegg_compound_id: | C00509 | | Drugbank_id: | EXPT02295 | | Logp: | 2.211 | | Cas_registry_number: | 480-41-1 | | Drug_category: | Chalcone-Flavonone Isomerase 1 inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
TRK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4710±0.00226274 |
| Normalized OD Score: sc h |
0.9470±0.00265124 |
| Z-Score: |
-1.6391±0.0767528 |
| p-Value: |
0.101696 |
| Z-Factor: |
-1.07619 |
| Fitness Defect: |
2.2858 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 21|H9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.80 Celcius | | Date: | 2008-03-14 YYYY-MM-DD | | Plate CH Control (+): | 0.040625±0.00056 | | Plate DMSO Control (-): | 0.47545000000000004±0.01659 | | Plate Z-Factor: | 0.8769 |
| png ps pdf |
| DBLink | Rows returned: 3 | |
| 932 |
5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
| 439246 |
(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
| 667495 |
(2R)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
| internal high similarity DBLink | Rows returned: 13 | << Back 1 2 3 |
| active | Cluster 14672 | Additional Members: 12 | Rows returned: 1 | |
|