| Compound Information | SONAR Target prediction |  | Name: | NARINGENIN |  | Unique Identifier: | SPE01500746  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 260.158 g/mol |  | X log p: | 12.698  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1ccc(cc1)C1CC(=O)c2c(O)cc(O)cc2O1 |  | Class: | flavan |  | Source: | widely distributed in plants |  | Therapeutics: | antiulcer, gibberellin antagonist |  | Generic_name: | NARINGENIN |  | Chemical_iupac_name: | NARINGENIN |  | Drug_type: | Experimental |  | Kegg_compound_id: | C00509 |  | Drugbank_id: | EXPT02295 |  | Logp: | 2.211 |  | Cas_registry_number: | 480-41-1 |  | Drug_category: | Chalcone-Flavonone Isomerase 1 inhibitor |  | Organisms_affected: | -1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RGP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4811±0.00657609 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9551±0.0148632 | 
	 
	
		| Z-Score: | 
		-1.1737±0.375292 | 
	 
	
		| p-Value: | 
		0.25693 | 
	 
	
		| Z-Factor: | 
		-2.5209 | 
	 
	
		| Fitness Defect: | 
		1.359 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 21|H9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.50 Celcius |  | Date: | 2008-06-26 YYYY-MM-DD |  | Plate CH Control (+): | 0.039825±0.00058 |  | Plate DMSO Control (-): | 0.4722±0.01853 |  | Plate Z-Factor: | 0.8579 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 932 | 
		5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one | 
	 
	
		| 439246 | 
		(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one | 
	 
	
		| 667495 | 
		(2R)-5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 13 | << Back 1 2 3 |   
 |  active | Cluster 14672 | Additional Members: 12 | Rows returned: 1 |  |   
 
 |