Compound Information | SONAR Target prediction | Name: | 7,2`-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500742 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc2C(=O)C=C(Oc2c1)c1ccccc1OC | Source: | ex Citrus spp |
Species: |
4932 |
Condition: |
MAD1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6017±0.0135764 |
Normalized OD Score: sc h |
0.8328±0.00601899 |
Z-Score: |
-9.5853±0.840753 |
p-Value: |
1.22687e-19 |
Z-Factor: |
-0.905146 |
Fitness Defect: |
43.5447 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2007-10-05 YYYY-MM-DD | Plate CH Control (+): | 0.039825±0.00238 | Plate DMSO Control (-): | 0.71225±0.05977 | Plate Z-Factor: | 0.7113 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688671 |
7-methoxy-2-(2-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 3887 | Additional Members: 4 | Rows returned: 1 | |
|