| Compound Information | SONAR Target prediction | | Name: | 7,2`-DIMETHOXYFLAVONE | | Unique Identifier: | SPE01500742 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc2C(=O)C=C(Oc2c1)c1ccccc1OC | | Source: | ex Citrus spp |
| Species: |
4932 |
| Condition: |
GAS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2138±0.0514067 |
| Normalized OD Score: sc h |
0.4899±0.0225939 |
| Z-Score: |
-5.1006±0.755868 |
| p-Value: |
0.00000249258 |
| Z-Factor: |
0.0485036 |
| Fitness Defect: |
12.9022 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|E6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.20 Celcius | | Date: | 2006-01-20 YYYY-MM-DD | | Plate CH Control (+): | 0.047475±0.00203 | | Plate DMSO Control (-): | 0.43855±0.06253 | | Plate Z-Factor: | 0.5214 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 688671 |
7-methoxy-2-(2-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 4 | |
| nonactive | Cluster 3887 | Additional Members: 4 | Rows returned: 1 | |
|