| Compound Information | SONAR Target prediction |
| Name: | 6,4--DIMETHOXYFLAVONE |
| Unique Identifier: | SPE01500741 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 268.18 g/mol |
| X log p: | 17.421 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 44.76 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | COc1ccc(cc1)C1Oc2ccc(OC)cc2C(=O)C=1 |
| Class: | flavone |
| Source: | derivative Cassia spectabilis |
| Found: 14 active | as graph: single | with analogs | << Back 11 12 13 14 Next >> |
| Species: | 4932 |
| Condition: | TPK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6356±0.00346482 |
| Normalized OD Score: sc h | 0.9117±0.0117318 |
| Z-Score: | -4.2540±0.491652 |
| p-Value: | 0.0000489414 |
| Z-Factor: | -0.104488 |
| Fitness Defect: | 9.9249 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 688670 | 6-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 6 |
| JFD 00149 | 0.9041 |
| SPE01504132 | 0.9122 |
| BTB 14489 | 0.9220 |
| BTB 10082 | 0.9362 |
| SPE00240958 | 0.9362 |
| JFD 02324 | 0.9574 |
| active | Cluster 12019 | Additional Members: 25 | Rows returned: 7 | 1 2 Next >> |
| SPE01504132 | 0.480769230769231 |
| SPE01505139 | 0.42 |
| LOPAC 01174 | 0.403846153846154 |
| LAT006E05 | 0.403846153846154 |
| BTB 13702 | 0.347826086956522 |
| SPE01500735 | 0.326530612244898 |
Service provided by the
Mike Tyers Laboratory